methyl trichloroacetate


methyl trichloroacetate; trichloroacetic acid methyl ester
Links:📏 NIST, ⚗️ ChemSynthesis
CAS RN:[598-99-2]
Formula:C3H3Cl3O2; 177.41 g/mol
InChiKey:VHFUHRXYRYWELT-UHFFFAOYSA-N
SMILES:COC(=O)C(Cl)(Cl)Cl
Molecular structure of methyl trichloroacetate
Density:1.488 g/mL
Molar volume:119.2 mL/mol
Refractive index:1.457
Molecular refractive power:32.47 mL/mol
Dielectric constant:8.79
Dipole moment:2.33 D
Melting point:-18 °C
Boiling point:152 °C
Surface tension:33.36 dyn/cm
Log10 partition octanol / water:2.03
Dimroth ET:39.6
Hildebrant solubility parameter (δ):9.6

Isomers

methyl trichloroacetate
Molecular structure of methyl trichloroacetate
2,2,3-trichloropropionic acid
Molecular structure of 2,2,3-trichloropropionic acid